1. Home
  2. Cyclobutanecarboxylic acid, 3-hydroxy-, ethyl ester

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Cyclobutanecarboxylic acid, 3-hydroxy-, ethyl ester

CCOC(=O)C1CC(C1)O Request for Quotation
Chemical Name: Cyclobutanecarboxylic acid, 3-hydroxy-, ethyl ester
CAS Number: 17205-02-6
Product Number: AG00ABTP(AGN-PC-03EZSQ)
Synonyms:
MDL No:
Molecular Formula: C7H12O3
Molecular Weight: 144.1684

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Ethyl 3-hydroxycyclobutanecarboxylate is a versatile compound widely used in chemical synthesis due to its unique structure and reactivity. This compound serves as a valuable building block in the synthesis of various organic molecules and pharmaceuticals. One key application of Ethyl 3-hydroxycyclobutanecarboxylate is its use as a starting material for the preparation of cyclic compounds, such as cyclobutane derivatives and other structurally related compounds. Additionally, this compound can be utilized in the synthesis of natural products and bioactive molecules, making it an essential tool in the field of medicinal chemistry. Its reactive hydroxyl group and cyclobutane ring provide opportunities for the introduction of different functional groups through various chemical transformations, allowing for the creation of diverse molecular structures. In summary, Ethyl 3-hydroxycyclobutanecarboxylate plays a crucial role in organic synthesis by enabling the construction of complex molecules with potential applications in drug discovery, material science, and other chemical fields.