1. Home
  2. 1H-Imidazolium, 1-ethenyl-3-methyl-, chloride

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1H-Imidazolium, 1-ethenyl-3-methyl-, chloride

CN1C[NH+](C=C1)C=C.[Cl-] Request for Quotation
Chemical Name: 1H-Imidazolium, 1-ethenyl-3-methyl-, chloride
CAS Number: 13474-25-4
Product Number: AG007064(AGN-PC-09TGEY)
Synonyms:
MDL No:
Molecular Formula: C6H11ClN2
Molecular Weight: 146.6179

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Methyl-1-vinylimidazolium chloride, also known as $name$, serves as a versatile chemical reagent in various chemical synthesis processes. With its unique structure, this compound is widely utilized in organic synthesis, particularly in the formation of polymer materials. By acting as a reactive intermediate, $name$ facilitates the functionalization of polymers, enabling the introduction of desired properties or functionalities.Furthermore, in the realm of catalysis, 3-Methyl-1-vinylimidazolium chloride plays a crucial role as a catalyst in multiple organic transformations. Its ability to activate substrates and accelerate reactions makes it an essential component in the synthesis of complex organic molecules. Additionally, this compound exhibits excellent stability under a broad range of reaction conditions, making it a reliable choice for various chemical transformations.Moreover, the unique properties of $name$ make it a preferred reagent for the synthesis of pharmaceutical intermediates. Its high selectivity and efficiency in mediating key chemical reactions ensure the production of high-quality intermediates essential for the pharmaceutical industry. Overall, the application of 3-Methyl-1-vinylimidazolium chloride in chemical synthesis showcases its significance in driving innovation and advancement in diverse fields of chemistry.