1. Home
  2. Benzenamine, 3-chloro-6-methyl-2-nitro-

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzenamine, 3-chloro-6-methyl-2-nitro-

[O-][N+](=O)c1c(Cl)ccc(c1N)C Request for Quotation
Chemical Name: Benzenamine, 3-chloro-6-methyl-2-nitro-
CAS Number: 13852-53-4
Product Number: AG0019D1(AGN-PC-0JPC56)
Synonyms:
MDL No:
Molecular Formula: C7H7ClN2O2
Molecular Weight: 186.5957

Identification/Properties

Properties
Storage:
Room Temperature;Light sensitive;

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Chloro-6-methyl-2-nitroaniline, also known as $name$, is a versatile chemical compound that finds wide application in chemical synthesis processes. In the field of organic chemistry, this compound serves as a key building block for the synthesis of various complex organic molecules and pharmaceutical intermediates. Its unique structure and reactivity make it a valuable reagent for the preparation of diverse compounds through a range of chemical reactions.One of the primary applications of 3-Chloro-6-methyl-2-nitroaniline is in the synthesis of dyes and pigments. This compound can undergo various chemical transformations to introduce different functional groups, allowing for the tailored synthesis of colored molecules with specific properties such as solubility, stability, and intensity. In addition, it is often used as a precursor for the preparation of fluorescent compounds used in imaging and labeling studies.Furthermore, 3-Chloro-6-methyl-2-nitroaniline plays a crucial role in the pharmaceutical industry as a key intermediate for the synthesis of various drugs and pharmaceuticals. Its ability to undergo selective reactions to form specific bonds makes it a valuable starting material for the construction of pharmacologically active compounds. By incorporating this compound into the synthesis of target molecules, chemists can efficiently access complex structures with potential biological activity.Overall, the diverse applicability of 3-Chloro-6-methyl-2-nitroaniline in chemical synthesis makes it an indispensable component in the arsenal of organic chemists. Its versatility and reactivity enable the efficient preparation of a wide range of compounds, making it a valuable tool for researchers and industries involved in the development of new materials, dyes, pharmaceuticals, and other chemical products.