Chemical Name: | Boronic acid, (4-chloro-3-nitrophenyl)- |
CAS Number: | 151169-67-4 |
Product Number: | AG001N57(AGN-PC-0LKZO0) |
Synonyms: | |
MDL No: | MFCD02258950 |
Molecular Formula: | C6H5BClNO4 |
Molecular Weight: | 201.3722 |
Boronic acid, B-(4-chloro-3-nitrophenyl)-, is a versatile compound that finds widespread application in chemical synthesis. This specific boronic acid derivative is valued for its ability to participate in various organic reactions, particularly in the formation of carbon-carbon bonds through Suzuki-Miyaura cross-coupling reactions. When used as a reagent in organic synthesis, it facilitates the construction of complex molecular structures by enabling the selective arylation of various substrates.Furthermore, the presence of the 4-chloro-3-nitrophenyl group in this boronic acid derivative imparts unique electronic and steric properties, which can influence the reactivity and selectivity of the compound in synthetic transformations. Its strategic incorporation into molecular frameworks offers chemists a powerful tool for designing and accessing structurally diverse molecules with tailored properties.Overall, B-(4-chloro-3-nitrophenyl)-boronic acid stands as a valuable reagent in the toolkit of synthetic chemists, offering opportunities for the efficient construction of complex organic molecules and the exploration of novel chemical space.