1. Home
  2. 2-Propen-1-ol, 3-phenyl-, formate

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-Propen-1-ol, 3-phenyl-, formate

O=COC/C=C/c1ccccc1 Request for Quotation
Chemical Name: 2-Propen-1-ol, 3-phenyl-, formate
CAS Number: 104-65-4
Product Number: AG007XPN(AGN-PC-0NVUA9)
Synonyms:
MDL No:
Molecular Formula: C10H10O2
Molecular Weight: 162.1852

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Cinnamyl formate is a versatile compound commonly used in chemical synthesis as a key building block in the production of various fragrances, flavors, and pharmaceuticals. Its unique chemical structure allows it to participate in a wide range of reactions, making it a valuable ingredient in synthetic chemistry.In chemical synthesis, cinnamyl formate serves as an important starting material for the preparation of cinnamic acid derivatives, which are widely employed in the fragrance industry. Its reactivity enables its transformation into various cinnamyl-derived compounds through processes such as esterification, hydrolysis, and decarboxylation.Furthermore, cinnamyl formate can be utilized for the synthesis of natural products and pharmaceutical intermediates due to its ability to undergo selective functional group transformations. Its presence in the reaction mixture can lead to the formation of complex molecular structures that exhibit desirable biological activities.Overall, the application of cinnamyl formate in chemical synthesis showcases its significance as a versatile and valuable compound that plays a crucial role in the creation of diverse products in industries ranging from perfumery to pharmaceuticals.