1. Home
  2. L-Valine, methyl ester

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

L-Valine, methyl ester

COC(=O)[C@H](C(C)C)N Request for Quotation
Chemical Name: L-Valine, methyl ester
CAS Number: 18869-42-6
Product Number: AG00B6RV(AGN-PC-0O5TQN)
Synonyms:
MDL No:
Molecular Formula: C6H13NO2
Molecular Weight: 131.17292

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Methyl valinate, a compound widely utilized in chemical synthesis, serves as a crucial building block in various industries. Its significant application lies in the fragrance and flavor industry, where it acts as a key ingredient in the formulation of perfumes, colognes, and food products. By incorporating methyl valinate into these products, manufacturers are able to enhance and modify their scent profiles, resulting in unique and appealing olfactory experiences for consumers.In addition to its role in the fragrance and flavor sector, methyl valinate also plays a vital part in organic synthesis. This compound serves as a versatile starting material for the production of numerous other compounds, including pharmaceuticals, agrochemicals, and polymers. Its chemical reactivity and ability to undergo various catalytic reactions make it an invaluable component in the synthesis of complex organic molecules with diverse applications.Furthermore, the utilization of methyl valinate in chemical synthesis extends to academic research and development activities. Chemists and researchers often rely on this compound to investigate and explore new reaction pathways, catalytic processes, and functional group transformations. Its use in laboratory settings contributes to the advancement of knowledge and innovation in the field of organic chemistry, paving the way for the discovery of novel compounds and technologies.Overall, methyl valinate's versatile applications in fragrance and flavor formulation, organic synthesis, and research make it an indispensable compound in the realm of chemical science and industry. Its unique properties and reactivity continue to inspire and drive advancements in various fields, shaping the landscape of modern chemistry and product development.