1. Home
  2. Butanoic acid, 3,4-dihydroxy-, (3S)-

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Butanoic acid, 3,4-dihydroxy-, (3S)-

OC[C@H](CC(=O)O)O Request for Quotation
Chemical Name: Butanoic acid, 3,4-dihydroxy-, (3S)-
CAS Number: 51267-44-8
Product Number: AG00DU9D(AGN-PC-0OBHA4)
Synonyms:
MDL No:
Molecular Formula: C4H8O4
Molecular Weight: 120.10392

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


(3S)-3,4-Dihydroxybutanoic acid, also known as erythronic acid, plays a crucial role in chemical synthesis as a valuable building block and chiral intermediate. This compound serves as a key precursor in the production of various pharmaceuticals and fine chemicals due to its ability to impart asymmetry and unique reactivity to synthetic pathways.One prominent application of (3S)-3,4-Dihydroxybutanoic acid is in the synthesis of chiral pharmaceutical compounds. Its chiral nature allows for the creation of enantiomerically pure molecules, which are essential for pharmaceuticals to exhibit desired biological activity and minimize side effects. By incorporating this compound into synthetic routes, chemists can efficiently access a wide range of biologically active molecules with high selectivity and purity.Additionally, (3S)-3,4-Dihydroxybutanoic acid serves as a versatile building block for the construction of complex organic molecules. Its hydroxyl groups and carboxylic acid functionality enable the formation of various chemical bonds, making it a valuable starting material for the synthesis of diverse compounds such as natural products, agrochemicals, and materials. Chemists can leverage the unique reactivity of this compound to introduce structural diversity and functional groups into target molecules, allowing for the design of novel compounds with tailored properties and activities.Overall, the application of (3S)-3,4-Dihydroxybutanoic acid in chemical synthesis offers a strategic approach to accessing chiral compounds and structurally complex molecules with high efficiency and precision. By harnessing the synthetic potential of this compound, researchers can advance the development of new pharmaceuticals, materials, and other valuable products with enhanced biological and functional properties.