1. Home
  2. Phosphoric acid, potassium salt

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Phosphoric acid, potassium salt

Request for Quotation
Chemical Name: Phosphoric acid, potassium salt
CAS Number: 16068-46-5
Product Number: AG00AOEQ(AGN-PC-0Q7X2K)
Synonyms:
MDL No:
Molecular Formula:
Molecular Weight:

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Potassium phosphate, often used in chemical synthesis processes, serves as a vital component in various applications within the field of chemistry. This versatile compound plays a crucial role as a source of both potassium and phosphate ions, which are key elements necessary for many chemical reactions. In chemical synthesis, potassium phosphate is frequently employed as a buffering agent to maintain a specific pH level during reactions. Additionally, it can act as a catalyst or a reagent, promoting desired chemical transformations or facilitating the formation of specific products. Its ability to aid in the production of organic compounds, inorganic complexes, and pharmaceuticals highlights its significance in the realm of chemical synthesis. Furthermore, potassium phosphate's solubility in water enhances its utility in solution-based reactions, making it a valuable resource for researchers and chemists alike.