1. Home
  2. Adenosine, 2'-deoxy-, cyclic 3',5'-(hydrogen phosphate), monosodiumsalt

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Adenosine, 2'-deoxy-, cyclic 3',5'-(hydrogen phosphate), monosodiumsalt

Nc1ncnc2c1ncn2[C@@H]1O[C@H]2[C@H](C1)OP(=O)(OC2)[O-].[Na+] Request for Quotation
Chemical Name: Adenosine, 2'-deoxy-, cyclic 3',5'-(hydrogen phosphate), monosodiumsalt
CAS Number: 93839-95-3
Product Number: AGN-PC-0W3H4E
Synonyms:
MDL No:
Molecular Formula: C10H11N5NaO5P
Molecular Weight: 335.188371

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Adenosine, 2'-deoxy-, cyclic 3',5'-(hydrogen phosphate), sodium salt (1:1) is a versatile compound widely utilized in chemical synthesis for its unique properties and functionalities. In organic chemistry, this compound serves as a crucial building block for the synthesis of nucleic acids, including DNA and RNA. Its cyclic structure, combined with the presence of a hydrogen phosphate group, allows for efficient incorporation into oligonucleotides and other nucleotide derivatives.Moreover, the sodium salt form of adenosine, 2'-deoxy-, cyclic 3',5'-(hydrogen phosphate) offers enhanced solubility and stability, making it particularly suitable for various synthetic reactions. This compound plays a pivotal role in the construction of nucleoside analogs, which are essential in drug development and medicinal chemistry. Additionally, it can be utilized in the preparation of modified nucleotides with specific functionalities for diverse research applications.Overall, the application of adenosine, 2'-deoxy-, cyclic 3',5'-(hydrogen phosphate), sodium salt (1:1) in chemical synthesis enables the efficient and controlled synthesis of nucleic acid derivatives, making it a valuable tool in the field of organic chemistry and molecular biology.