1. Home
  2. 1,2-Pyrrolidinedicarboxylicacid, 4-hydroxy-, 1-(1,1-dimethylethyl) ester, (4S)-rel-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1,2-Pyrrolidinedicarboxylicacid, 4-hydroxy-, 1-(1,1-dimethylethyl) ester, (4S)-rel-

O[C@@H]1CN(C(C1)C(=O)O)C(=O)OC(C)(C)C Request for Quotation
Chemical Name: 1,2-Pyrrolidinedicarboxylicacid, 4-hydroxy-, 1-(1,1-dimethylethyl) ester, (4S)-rel-
CAS Number: 946610-68-0
Product Number: AG00IIFE(AGN-PC-0W4976)
Synonyms:
MDL No:
Molecular Formula: C10H17NO5
Molecular Weight: 231.24568

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


trans-1-(tert-Butoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid, also known as $name$, is a key compound widely used in chemical synthesis due to its versatile applications. This compound plays a crucial role in organic chemistry as a building block for the synthesis of various complex molecules. In particular, it is commonly utilized in the production of pharmaceuticals, agrochemicals, and advanced materials.One of the primary uses of $name$ in chemical synthesis is as a protected amino acid derivative. The tert-butoxycarbonyl (Boc) group serves as a protecting group for the amine functionality, allowing for selective manipulation of other functional groups in the molecule. This protection strategy ensures the desired chemical reactions occur at specific sites within the molecule, enabling the synthesis of highly intricate and tailored compounds.Furthermore, the hydroxyl and carboxylic acid functionalities in $name$ offer additional synthetic possibilities. These reactive groups can participate in various chemical transformations, such as esterification, amidation, and cyclization reactions, facilitating the construction of diverse molecular structures. The presence of the pyrrolidine ring further enhances the compound's utility by providing stereochemical control and molecular rigidity in the synthesized products.Overall, the strategic incorporation of trans-1-(tert-Butoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid in chemical synthesis enables chemists to access novel compounds with tailored properties and biological activities. Its versatility and compatibility with various synthetic methodologies make it a valuable tool for the development of new molecules with potential applications in medicine, agriculture, and material science.