1. Home
  2. Ethanaminium, N-ethyl-N,N-dimethyl-, hydroxide

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Ethanaminium, N-ethyl-N,N-dimethyl-, hydroxide

Request for Quotation
Chemical Name: Ethanaminium, N-ethyl-N,N-dimethyl-, hydroxide
CAS Number: 95500-19-9
Product Number: AG003PHW(AGN-PC-0W53IJ)
Synonyms:
MDL No:
Molecular Formula:
Molecular Weight:

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Diethyldimethylammonium hydroxide is a versatile chemical reagent used in various aspects of chemical synthesis. Its primary application lies in its role as a strong organic base that can participate in reactions requiring deprotonation or proton transfer.One common use of Diethyldimethylammonium hydroxide is in the production of quaternary ammonium salts through the quaternization of tertiary amines. This process involves the reaction of Diethyldimethylammonium hydroxide with an alkyl halide, resulting in the formation of a positively charged nitrogen atom. These quaternary ammonium salts find applications in organic synthesis, phase-transfer catalysts, and antimicrobial agents.Additionally, Diethyldimethylammonium hydroxide can serve as a strong base in the presence of acids, facilitating various organic transformations such as nucleophilic substitutions, deprotonation reactions, and elimination reactions. Its high basicity makes it an effective catalyst in reactions requiring basic conditions.Furthermore, the unique structural properties of Diethyldimethylammonium hydroxide make it a valuable reagent in the synthesis of certain coordination complexes and organometallic compounds. Its ability to stabilize certain reactive intermediates and facilitate complexation reactions makes it a crucial component in the preparation of advanced materials and catalysts.