1. Home
  2. (S)-3-(1-Azidoethyl)-2-chloro-8-fluoroquinoline

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

(S)-3-(1-Azidoethyl)-2-chloro-8-fluoroquinoline

[N-]=[N+]=N[C@H](c1cc2cccc(c2nc1Cl)F)C Request for Quotation
Chemical Name: (S)-3-(1-Azidoethyl)-2-chloro-8-fluoroquinoline
CAS Number: 1065481-28-8
Product Number: AG0094TI(AGN-PC-0WA2VU)
Synonyms:
MDL No:
Molecular Formula: C11H8ClFN4
Molecular Weight: 250.6594232

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The (S)-3-(1-Azidoethyl)-2-chloro-8-fluoroquinoline is a versatile compound widely utilized in chemical synthesis due to its unique properties and reactivity. As a chiral azidoalkylaryl chloride, it serves as a valuable building block in the development of new pharmaceuticals, agrochemicals, and functional materials. In chemical synthesis, this compound acts as a key intermediate in the creation of structurally diverse molecules through various transformations. Its azido group enables the introduction of nitrogen functionality, while the chloro and fluoro substituents provide opportunities for further derivatization. This enables the synthesis of complex molecules with specific stereochemical and structural attributes.Additionally, the (S)-3-(1-Azidoethyl)-2-chloro-8-fluoroquinoline can be utilized in the preparation of asymmetric catalysts and ligands, contributing to advancements in asymmetric synthesis and catalysis. Its chiral nature imparts selectivity in reactions, allowing for the efficient production of enantiomerically pure compounds.Overall, the versatile application of (S)-3-(1-Azidoethyl)-2-chloro-8-fluoroquinoline in chemical synthesis underscores its significance in modern organic chemistry and its potential for the development of innovative and functionally diverse molecules.