1. Home
  2. 3-Methyloxathiazolidine 2,2-dioxide

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

3-Methyloxathiazolidine 2,2-dioxide

Request for Quotation
Chemical Name: 3-Methyloxathiazolidine 2,2-dioxide
CAS Number: 1201897-41-7
Product Number: AGN-PC-0WA8VB
Synonyms:
MDL No:
Molecular Formula:
Molecular Weight:

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Methyloxathiazolidine 2,2-Dioxide is a versatile compound commonly utilized in chemical synthesis processes due to its unique properties and versatile applications. In the realm of organic chemistry, this compound serves as a valuable building block for the synthesis of various heterocyclic compounds and pharmaceutical intermediates. Its structural features enable it to participate in a wide range of reactions, making it a valuable tool for organic chemists.One of the key applications of 3-Methyloxathiazolidine 2,2-Dioxide is as a precursor in the synthesis of bioactive molecules and pharmaceuticals. By incorporating this compound into the molecular structure of target compounds, researchers can introduce specific functional groups or modify the overall reactivity and properties of the resulting products. This flexibility makes it an essential component in the development of new drugs and therapeutic agents.Furthermore, 3-Methyloxathiazolidine 2,2-Dioxide is commonly employed in the construction of complex organic molecules through multistep synthesis routes. Its reactivity and compatibility with various reaction conditions make it an ideal starting material for the creation of intricate molecular scaffolds. By strategically incorporating this compound into synthetic pathways, chemists can efficiently access a wide range of structurally diverse compounds for various applications in the fields of medicine, materials science, and agrochemicals.