1. Home
  2. 5-(cyclopropylethynyl)pyridin-3-ylboronic acid

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

5-(cyclopropylethynyl)pyridin-3-ylboronic acid

OB(c1cncc(c1)C#CC1CC1)O Request for Quotation
Chemical Name: 5-(cyclopropylethynyl)pyridin-3-ylboronic acid
CAS Number: 1189372-89-1
Product Number: AG0039JW(AGN-PC-0WAAU5)
Synonyms:
MDL No:
Molecular Formula: C10H10BNO2
Molecular Weight: 187.0029

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


5-(Cyclopropylethynyl)pyridin-3-ylboronic acid is a versatile chemical reagent commonly utilized in organic synthesis for its unique properties and reactivity. This compound serves as a valuable building block in the construction of various organic molecules, particularly in the field of medicinal chemistry and drug development.One of the key applications of 5-(Cyclopropylethynyl)pyridin-3-ylboronic acid is its role as a potent and selective Suzuki-Miyaura coupling partner. This reaction, catalyzed by palladium, enables the cross-coupling of the boronic acid moiety with a diverse range of aryl halides or pseudohalides. This versatile coupling reaction allows for the rapid and efficient assembly of complex molecular structures, making it a powerful tool in the synthesis of pharmaceuticals, agrochemicals, and materials science.Additionally, 5-(Cyclopropylethynyl)pyridin-3-ylboronic acid can participate in various other transformations such as Sonogashira coupling, Heck reactions, and other C-C bond-forming reactions. Its unique cyclopropyl-ethynyl substitution pattern imparts distinct steric and electronic properties to the molecule, influencing its reactivity and selectivity in a synthetic context.Overall, 5-(Cyclopropylethynyl)pyridin-3-ylboronic acid is a valuable reagent in chemical synthesis, offering chemists a powerful tool for the construction of complex organic molecules with potential applications in drug discovery and development.