1. Home
  2. Methyl 1-(3-Bromophenyl)-4-oxocyclohexanecarboxylate

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Methyl 1-(3-Bromophenyl)-4-oxocyclohexanecarboxylate

COC(=O)C1(CCC(=O)CC1)c1cccc(c1)Br Request for Quotation
Chemical Name: Methyl 1-(3-Bromophenyl)-4-oxocyclohexanecarboxylate
CAS Number: 1385694-79-0
Product Number: AG0018R6(AGN-PC-0WADNM)
Synonyms:
MDL No: MFCD22423146
Molecular Formula: C14H15BrO3
Molecular Weight: 311.1711

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Methyl 1-(3-bromophenyl)-4-oxocyclohexanecarboxylate is a versatile compound that finds wide application in chemical synthesis. With its unique structure and reactivity, this compound serves as a valuable building block for the synthesis of a variety of organic compounds.One key application of Methyl 1-(3-bromophenyl)-4-oxocyclohexanecarboxylate is in the preparation of pharmaceutical intermediates. Its controlled reactivity allows for the selective modification of organic molecules, making it an essential component in the synthesis of numerous pharmaceutical products.Furthermore, this compound can be utilized in the production of specialty chemicals and agrochemicals. Its functional groups enable efficient bond formation and manipulation, facilitating the creation of complex organic molecules with high purity and yield.Additionally, Methyl 1-(3-bromophenyl)-4-oxocyclohexanecarboxylate is employed in the development of advanced materials such as polymers and dyes. Its structural properties contribute to the enhancement of material properties, leading to the creation of innovative materials with tailored functionalities.In summary, Methyl 1-(3-bromophenyl)-4-oxocyclohexanecarboxylate plays a crucial role in chemical synthesis, enabling the efficient construction of diverse organic compounds essential for various industrial applications.