1. Home
  2. 1H-Indazol-4-amine, 3-methyl-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1H-Indazol-4-amine, 3-methyl-

Request for Quotation
Chemical Name: 1H-Indazol-4-amine, 3-methyl-
CAS Number: 945397-02-4
Product Number: AG01FWSS(AGN-PC-0WAJHJ)
Synonyms:
MDL No:
Molecular Formula:
Molecular Weight:

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Methyl-1H-indazol-4-amine, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block for the creation of various organic compounds. Its unique molecular structure and functional groups make it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials.In chemical synthesis, 3-Methyl-1H-indazol-4-amine can serve as a key starting material for the preparation of diverse heterocyclic compounds. By incorporating this compound into reactions with other reagents, chemists can generate new structures with enhanced properties and potential applications. Its ability to undergo various transformations, such as substitution, addition, and cyclization reactions, makes it a valuable tool in the design of novel molecules.Furthermore, the presence of the methyl and amino groups in 3-Methyl-1H-indazol-4-amine allows for further functionalization, enabling the introduction of additional substituents or modifications to tailor the compound's properties for specific purposes. This flexibility in structural manipulation makes it a versatile and valuable component in the synthesis of complex organic molecules with potential biological or industrial significance.