Chemical Name: | bis(o-tolyl)chlorophosphine |
CAS Number: | 36042-94-1 |
Product Number: | AG003POS(AGN-PC-0WALG9) |
Synonyms: | |
MDL No: | |
Molecular Formula: | |
Molecular Weight: |
DI-O-TOLYLCHLOROPHOSPHINE is a versatile chemical compound widely used in various chemical synthesis reactions. Its unique properties make it a valuable reagent in the preparation of organophosphorus compounds. Due to its ability to act as a nucleophile, DI-O-TOLYLCHLOROPHOSPHINE is commonly employed in the formation of phosphorus-carbon bonds, which are essential in the synthesis of a wide range of organic molecules. Additionally, this compound serves as a useful building block in the production of pharmaceuticals, agrochemicals, and materials with complex molecular structures. Its role in promoting selective chemical transformations and facilitating the creation of new chemical entities underscores its significance in modern synthetic chemistry.