1. Home
  2. methyl 3,3-difluoropiperidine-4-carboxylate;hydrochloride

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

methyl 3,3-difluoropiperidine-4-carboxylate;hydrochloride

COC(=O)C1CCNCC1(F)F.Cl Request for Quotation
Chemical Name: methyl 3,3-difluoropiperidine-4-carboxylate;hydrochloride
CAS Number: 1779974-06-9
Product Number: AG01X9O3()
Synonyms:
MDL No:
Molecular Formula:
Molecular Weight:

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Methyl 3,3-difluoropiperidine-4-carboxylate hydrochloride is a valuable compound widely used in chemical synthesis processes. This compound plays a crucial role in various organic reactions due to its unique chemical properties. Its fluorinated piperidine structure makes it a versatile building block in the development of complex molecules and pharmaceutical intermediates. In chemical synthesis, this compound serves as a key reagent for the introduction of fluorine atoms into target molecules, enabling the creation of novel compounds with enhanced biological activities. Additionally, methyl 3,3-difluoropiperidine-4-carboxylate hydrochloride can be utilized in the preparation of fluorinated building blocks for drug discovery and development, offering new possibilities for the synthesis of potential therapeutics. Its application in chemical synthesis extends to the production of specialty chemicals and materials, showcasing its significance in advancing modern chemical technologies. With its diverse capabilities and reactivity, this compound holds great promise in driving innovation and progress in the field of organic chemistry.