1. Home
  2. Quinoline, 5-(chloromethyl)-

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Quinoline, 5-(chloromethyl)-

ClCc1cccc2c1cccn2 Request for Quotation
Chemical Name: Quinoline, 5-(chloromethyl)-
CAS Number: 110333-07-8
Product Number: AG0094JP(AGN-PC-002B42)
Synonyms:
MDL No:
Molecular Formula: C10H8ClN
Molecular Weight: 177.6302

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


5-(Chloromethyl)quinoline is a versatile chemical compound that plays a crucial role in chemical synthesis. This compound is widely utilized as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure and reactivity make it valuable in the creation of complex molecules in organic chemistry.In chemical synthesis, 5-(Chloromethyl)quinoline serves as a valuable intermediate for introducing the chloromethyl group into target molecules. This chloromethyl group can undergo various chemical transformations such as nucleophilic substitution reactions, condensation reactions, and palladium-catalyzed cross-coupling reactions. These reactions enable chemists to introduce diverse functional groups and create structurally complex compounds efficiently.Furthermore, 5-(Chloromethyl)quinoline can act as a precursor for the synthesis of biologically active compounds, including antimalarials, antivirals, antibacterials, and anti-inflammatory agents. Its presence in the molecular structure imparts specific properties and activities to the final products, making it a valuable molecule in drug discovery and development.Overall, the application of 5-(Chloromethyl)quinoline in chemical synthesis showcases its importance as a versatile building block for creating diverse compounds with potential pharmaceutical and agrochemical applications.