1. Home
  2. 2-Pyridinemethanol, 4-nitro-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-Pyridinemethanol, 4-nitro-

OCc1nccc(c1)[N+](=O)[O-] Request for Quotation
Chemical Name: 2-Pyridinemethanol, 4-nitro-
CAS Number: 98197-88-7
Product Number: AG003F2I(AGN-PC-002GH0)
Synonyms:
MDL No: MFCD07774099
Molecular Formula: C6H6N2O3
Molecular Weight: 154.1234

Identification/Properties

Properties
Storage:
2-8℃;
Form:
Solid

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


2-(Hydroxymethyl)-4-nitropyridine is a versatile chemical compound widely used in chemical synthesis processes. Specifically, this compound is utilized as a key intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and reactivity make it a valuable building block for the synthesis of complex organic molecules.In chemical synthesis, 2-(Hydroxymethyl)-4-nitropyridine serves as a crucial starting material for the preparation of biologically active compounds. Its presence in a reaction allows for the introduction of both hydroxymethyl and nitro functional groups into the targeted molecule, leading to the formation of diverse structures with specific properties and activities.This compound is particularly essential in the pharmaceutical industry, where it is employed in the synthesis of drug candidates and active pharmaceutical ingredients. Its ability to undergo various chemical transformations, such as reduction, substitution, and addition reactions, enables chemists to access a wide range of molecular scaffolds that can exhibit desired biological activities.Additionally, 2-(Hydroxymethyl)-4-nitropyridine plays a crucial role in the development of new materials and specialty chemicals. Its reactivity and compatibility with different reaction conditions make it a valuable asset in creating custom-designed molecules for specific applications in materials science, catalysis, and other industrial processes.Overall, the application of 2-(Hydroxymethyl)-4-nitropyridine in chemical synthesis showcases its importance as a versatile building block for the construction of complex organic molecules with diverse functionality and pharmacological properties.