1. Home
  2. Phosphonic acid, [(4-fluorophenyl)methyl]-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Phosphonic acid, [(4-fluorophenyl)methyl]-

Fc1ccc(cc1)CP(=O)(O)O Request for Quotation
Chemical Name: Phosphonic acid, [(4-fluorophenyl)methyl]-
CAS Number: 80395-14-8
Product Number: AG008MS6(AGN-PC-0030W5)
Synonyms:
MDL No:
Molecular Formula: C7H8FO3P
Molecular Weight: 190.1088

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Phosphonic acid, [(4-fluorophenyl)methyl]-, is a versatile compound commonly used in chemical synthesis. With its unique structure and properties, this phosphonic acid derivative plays a crucial role in various reactions and processes in the field of organic chemistry.In chemical synthesis, Phosphonic acid, [(4-fluorophenyl)methyl]- is often utilized as a key building block for the creation of pharmaceuticals, agrochemicals, and specialty chemicals. Its functional groups allow for selective reactions and modifications, making it a valuable intermediate in the production of complex organic molecules.Furthermore, this compound can serve as a ligand in coordination chemistry, facilitating the formation of metal complexes with specific catalytic properties. Its ability to chelate metal ions makes it particularly useful in the development of catalysts for various chemical transformations.Overall, Phosphonic acid, [(4-fluorophenyl)methyl]- plays a crucial role in the advancement of chemical synthesis, offering researchers a versatile tool for the design and preparation of novel compounds with diverse applications.