1. Home
  2. 1-Hexyn-3-ol, 1-phenyl-, (+)-

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1-Hexyn-3-ol, 1-phenyl-, (+)-

CCCC(C#Cc1ccccc1)O Request for Quotation
Chemical Name: 1-Hexyn-3-ol, 1-phenyl-, (+)-
CAS Number: 1817-51-2
Product Number: AG00232F(AGN-PC-005SMX)
Synonyms:
MDL No:
Molecular Formula: C12H14O
Molecular Weight: 174.2390

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


1-Phenyl-1-hexyn-3-ol, also known as phenylacetylene alcohol, is a versatile compound widely utilized in organic chemical synthesis. Its unique structure, featuring both a phenyl group and an alkyne functional group, makes it a valuable building block for creating various complex organic molecules.In chemical synthesis, 1-Phenyl-1-hexyn-3-ol serves as a key intermediate in the preparation of heterocycles, pharmaceuticals, and agrochemicals. Its alkyne moiety can undergo various transformations such as Sonogashira coupling, click chemistry reactions, and metal-catalyzed cross-coupling reactions, enabling the introduction of diverse functional groups into the molecule.Furthermore, the phenyl group in 1-Phenyl-1-hexyn-3-ol provides a site for further derivatization, allowing for the modification of its chemical properties and reactivity. This compound's ability to participate in multiple types of reactions makes it a valuable tool for organic chemists seeking to synthesize complex compounds efficiently and selectively.Overall, 1-Phenyl-1-hexyn-3-ol plays a crucial role in modern organic synthesis by enabling the construction of intricate molecular structures with precision and control. Its versatility and reactivity make it an indispensable component in the toolkit of synthetic chemists working in various research and industrial applications.