1. Home
  2. Phenol, 2,2'-(1,2-diamino-1,2-ethanediyl)bis-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Phenol, 2,2'-(1,2-diamino-1,2-ethanediyl)bis-

NC(C(c1ccccc1O)N)c1ccccc1O Request for Quotation
Chemical Name: Phenol, 2,2'-(1,2-diamino-1,2-ethanediyl)bis-
CAS Number: 51208-45-8
Product Number: AG00DLXX(AGN-PC-00UR0X)
Synonyms:
MDL No:
Molecular Formula: C14H16N2O2
Molecular Weight: 244.28904

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The compound phenol, 2,2'-(1,2-diamino-1,2-ethanediyl)bis-, also known as bis-phenol E, plays a crucial role in chemical synthesis as a versatile building block. It is commonly used as a key intermediate in the production of various polymers and resins due to its unique chemical properties.In chemical synthesis, bis-phenol E is widely utilized as a cross-linking agent in the synthesis of epoxy resins. Epoxy resins produced from bis-phenol E exhibit excellent adhesion, thermal resistance, and mechanical properties, making them ideal for applications such as coatings, adhesives, and composites.Furthermore, bis-phenol E is a valuable component in the manufacture of specialty polymers, where its structure allows for precise control over polymer properties. Its bifunctional nature enables the formation of complex polymer structures with tailored characteristics such as flexibility, durability, and chemical resistance.Overall, the application of phenol, 2,2'-(1,2-diamino-1,2-ethanediyl)bis- in chemical synthesis plays a crucial role in producing a wide range of high-performance materials essential for various industries.