1. Home
  2. Benzoic acid, 5-methyl-2-(1-methylethyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzoic acid, 5-methyl-2-(1-methylethyl)-

Cc1ccc(c(c1)C(=O)O)C(C)C Request for Quotation
Chemical Name: Benzoic acid, 5-methyl-2-(1-methylethyl)-
CAS Number: 4424-25-3
Product Number: AG00DL32(AGN-PC-036P5V)
Synonyms:
MDL No:
Molecular Formula: C11H14O2
Molecular Weight: 178.22766

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


5-Methyl-2-(1-methylethyl)benzoic acid, also known as pivalic acid, plays a crucial role in chemical synthesis as a versatile building block. This compound is commonly utilized in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Due to its unique structure containing both an aromatic ring and a branched side chain, 5-Methyl-2-(1-methylethyl)benzoic acid can be easily functionalized to introduce specific chemical groups required for the synthesis of target molecules. Its reactivity allows for the formation of various derivatives through esterification, amidation, or other chemical transformations, making it a valuable intermediate in organic synthesis. Additionally, the substituents on the aromatic ring can also be further modified to tune the properties of the final products. The application of 5-Methyl-2-(1-methylethyl)benzoic acid in chemical synthesis enables chemists to efficiently access a wide range of compounds with diverse functionalities for applications in multiple industries.