1. Home
  2. Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-(1-methylethyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-(1-methylethyl)-

CC(C1NC(=O)C2N(C1=O)CCC2)C Request for Quotation
Chemical Name: Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-(1-methylethyl)-
CAS Number: 5654-87-5
Product Number: AG00ELQJ(AGN-PC-03FGQI)
Synonyms:
MDL No:
Molecular Formula: C10H16N2O2
Molecular Weight: 196.24624

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Cyclo-Val-Pro-diketopiperazine is a versatile compound widely used in chemical synthesis as a key building block for the creation of cyclic peptide-based molecules. With its unique structure containing both a cyclic ring and a diketopiperazine scaffold, this compound plays a crucial role in the development of pharmaceuticals, agrochemicals, and materials science.In chemical synthesis, Cyclo-Val-Pro-diketopiperazine serves as a valuable intermediate for the construction of complex peptides and peptidomimetics. Its ability to form stable, rigid structures makes it an ideal component for enhancing the stability and bioactivity of peptide-based drugs. By incorporating Cyclo-Val-Pro-diketopiperazine into the molecular design, chemists can control the conformational flexibility and improve the pharmacokinetic properties of peptide therapeutics.Furthermore, the unique structural features of Cyclo-Val-Pro-diketopiperazine make it an excellent candidate for the development of novel small molecules with diverse biological activities. Its rigid framework and potential for functionalization offer researchers the opportunity to explore new chemical space and design compounds with specific target-binding capabilities.Overall, Cyclo-Val-Pro-diketopiperazine plays a crucial role in advancing the field of chemical synthesis by enabling the efficient construction of diverse molecular architectures with applications in drug discovery, materials science, and beyond.