1. Home
  2. 3-methoxy-1,5-naphthyridine-4-carbaldehyde

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

3-methoxy-1,5-naphthyridine-4-carbaldehyde

O=Cc1c(OC)cnc2c1nccc2 Request for Quotation
Chemical Name: 3-methoxy-1,5-naphthyridine-4-carbaldehyde
CAS Number: 1056877-13-4
Product Number: AG00996Z(AGN-PC-077X1T)
Synonyms:
MDL No:
Molecular Formula: C10H8N2O2
Molecular Weight: 188.1827

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The 3-Methoxy-1,5-naphthyridine-4-carbaldehyde is a versatile compound widely utilized in chemical synthesis due to its unique properties and reactivity. This aldehyde compound serves as a key building block in the development of various organic molecules, making it a valuable tool for synthesizing complex chemical structures.One of the primary applications of 3-Methoxy-1,5-naphthyridine-4-carbaldehyde is in the synthesis of heterocyclic compounds, particularly in the pharmaceutical industry. Its ability to form a diverse range of chemical bonds enables the efficient construction of biologically active molecules, potential drug candidates, and advanced materials. Additionally, this compound can be employed in the creation of novel fluorescent dyes and materials used in the field of materials science.Furthermore, 3-Methoxy-1,5-naphthyridine-4-carbaldehyde plays a crucial role in the development of ligands for coordination chemistry and catalysis. Its unique chemical structure allows for precise modification and functionalization, leading to the creation of tailored ligands with specific coordination properties. These ligands find applications in various catalytic reactions, enabling the synthesis of fine chemicals and pharmaceutical intermediates with high efficiency and selectivity.