1. Home
  2. 8-chloro-11-(1-hydroxypiperidin-4-ylidene)-5,6-dihydrobenzo[1,2]cyclohepta[2,4-b]pyridine

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

8-chloro-11-(1-hydroxypiperidin-4-ylidene)-5,6-dihydrobenzo[1,2]cyclohepta[2,4-b]pyridine

ON1CCC(=C2c3ccc(cc3CCc3c2nccc3)Cl)CC1 Request for Quotation
Chemical Name: 8-chloro-11-(1-hydroxypiperidin-4-ylidene)-5,6-dihydrobenzo[1,2]cyclohepta[2,4-b]pyridine
CAS Number: 1193725-73-3
Product Number: AG008WO7(AGN-PC-09WMIX)
Synonyms:
MDL No:
Molecular Formula: C19H19ClN2O
Molecular Weight: 326.81996

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Desloratadine N-Hydroxypiperidine is a versatile compound commonly employed in chemical synthesis as a key intermediate for the production of various pharmaceutical products. With its unique chemical properties and structural characteristics, Desloratadine N-Hydroxypiperidine acts as a crucial building block in the creation of potent medications used to treat a range of health conditions.In chemical synthesis, Desloratadine N-Hydroxypiperidine serves as a valuable precursor for the preparation of pharmaceuticals such as antihistamines, antivirals, and other therapeutic agents. Its reactivity and stability make it an ideal starting material for the synthesis of complex organic molecules, allowing chemists to efficiently produce high-quality pharmaceutical compounds through controlled reaction pathways.By incorporating Desloratadine N-Hydroxypiperidine into chemical reactions, researchers can access a wide array of functional groups and stereochemical features necessary for designing innovative drugs with enhanced efficacy and safety profiles. This compound's role in chemical synthesis demonstrates its significance in advancing the field of medicinal chemistry and drug development, ultimately leading to the creation of novel treatments that benefit patients worldwide.