1. Home
  2. 3-fluoro-5-methoxypyridine-2-sulfonyl chloride

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

3-fluoro-5-methoxypyridine-2-sulfonyl chloride

COc1cnc(c(c1)F)S(=O)(=O)Cl Request for Quotation
Chemical Name: 3-fluoro-5-methoxypyridine-2-sulfonyl chloride
CAS Number: 1261870-77-2
Product Number: AG000S26(AGN-PC-0AM1NE)
Synonyms:
MDL No:
Molecular Formula: C6H5ClFNO3S
Molecular Weight: 225.6252

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Fluoro-5-methoxypyridine-2-sulfonyl chloride is a versatile chemical compound widely used in chemical synthesis processes. This compound serves as a valuable building block in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique molecular structure allows for selective functionalization, making it an essential reagent in organic synthesis.One key application of 3-Fluoro-5-methoxypyridine-2-sulfonyl chloride is in the synthesis of complex organic molecules, where it can be employed as an intermediate in the preparation of novel drug candidates or agrochemicals. Its sulfonyl chloride group makes it a useful precursor for introducing both fluorine and methoxy functionalities into target molecules, enhancing their biological or chemical properties.Furthermore, this compound can participate in various chemical reactions, such as nucleophilic substitution, palladium-catalyzed cross-coupling, and further functional group modifications. Its fluoro and methoxy substituents provide opportunities for regioselective and stereoselective transformations, allowing chemists to tailor the structure of the final compound to achieve desired properties.In summary, 3-Fluoro-5-methoxypyridine-2-sulfonyl chloride plays a crucial role in the field of chemical synthesis by enabling the efficient construction of complex molecules with specific functionalities. Its versatility and reactivity make it a valuable tool for researchers and scientists working in drug discovery, agrochemical development, and other areas of organic chemistry.