1. Home
  2. (5-fluoro-6-methylpyridin-3-yl)methanol

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

(5-fluoro-6-methylpyridin-3-yl)methanol

OCc1cnc(c(c1)F)C Request for Quotation
Chemical Name: (5-fluoro-6-methylpyridin-3-yl)methanol
CAS Number: 917835-69-9
Product Number: AG00IGVG(AGN-PC-0C4KM8)
Synonyms:
MDL No: MFCD19440436
Molecular Formula: C7H8FNO
Molecular Weight: 141.1429

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Fluoro-5-(hydroxymethyl)-2-methylpyridine is a versatile compound that finds application in various chemical synthesis processes. It serves as a valuable building block in the creation of complex organic molecules due to its unique structure and reactivity. One key use of this compound is as a precursor for the synthesis of pharmaceutical agents and agrochemicals.In chemical synthesis, 3-Fluoro-5-(hydroxymethyl)-2-methylpyridine can be utilized as a starting material to introduce specific functional groups or modify existing ones. Its fluoro and hydroxymethyl moieties provide opportunities for further derivatization, allowing chemists to tailor the molecule for specific purposes. Additionally, the presence of the pyridine ring confers aromatic properties, which can be exploited in the design of bioactive compounds.Furthermore, the substitution pattern of the compound offers control over regioselectivity in reactions, enabling the synthesis of diverse products with potential biological or material applications. Overall, the strategic incorporation of 3-Fluoro-5-(hydroxymethyl)-2-methylpyridine in chemical syntheses contributes to the development of innovative compounds with enhanced properties and functionalities.