1. Home
  2. 3-amino-6-chloro-2-methylpyridine-4-carboxylic acid

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

3-amino-6-chloro-2-methylpyridine-4-carboxylic acid

Clc1nc(C)c(c(c1)C(=O)O)N Request for Quotation
Chemical Name: 3-amino-6-chloro-2-methylpyridine-4-carboxylic acid
CAS Number: 1073182-66-7
Product Number: AG01ECT4(AGN-PC-0CVR5I)
Synonyms:
MDL No:
Molecular Formula: C7H7ClN2O2
Molecular Weight: 186.59568

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


3-Amino-6-chloro-2-methylisonicotinic acid is an important chemical compound that finds widespread application in various chemical synthesis processes. This compound serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its unique structure and properties make it a valuable building block in the development of novel molecules with diverse functionalities.In chemical synthesis, 3-Amino-6-chloro-2-methylisonicotinic acid can be used as a precursor in the preparation of biologically active compounds such as anti-cancer agents, antimicrobial drugs, and anti-inflammatory medications. Its amino and chloro functional groups allow for selective derivatization to introduce specific chemical moieties that are crucial for enhancing the pharmacological properties of the final products.Furthermore, the presence of the methyl and isonicotinic acid groups in the molecule provides versatility in synthetic routes, enabling chemists to explore various reactivity pathways to access structurally complex molecules. This compound's compatibility with a wide range of organic reactions makes it a valuable tool for chemists involved in drug discovery, material science, and other research areas where the design and synthesis of new compounds are essential.Overall, the application of 3-Amino-6-chloro-2-methylisonicotinic acid in chemical synthesis enables researchers to access a diverse array of compounds with therapeutic potential and other beneficial properties, making it a versatile and indispensable building block in modern organic chemistry.