1. Home
  2. Cyclododecanecarboxylic acid

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Cyclododecanecarboxylic acid

OC(=O)C1CCCCCCCCCCC1 Request for Quotation
Chemical Name: Cyclododecanecarboxylic acid
CAS Number: 884-36-6
Product Number: AG003P3Z(AGN-PC-0JL9IE)
Synonyms:
MDL No:
Molecular Formula: C13H24O2
Molecular Weight: 212.32846

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Cyclododecanecarboxylic acid is a versatile compound widely used in chemical synthesis as a building block for various derivatives. Its unique structure, characterized by a cyclic backbone and a carboxylic acid functional group, lends itself to a range of applications in organic chemistry.One of the primary uses of cyclododecanecarboxylic acid is as a precursor for the synthesis of cycloalkane-based polymers and resins. By reacting cyclododecanecarboxylic acid with different monomers or by polymerizing it directly, it is possible to produce high-performance materials with tailored properties such as thermal stability, chemical resistance, and mechanical strength.Furthermore, cyclododecanecarboxylic acid can also serve as a starting material for the preparation of various specialty chemicals and pharmaceutical intermediates. Through functional group transformations or structural modifications, chemists can access a diverse array of compounds for applications in drug discovery, materials science, and agrochemicals.In summary, cyclododecanecarboxylic acid plays a crucial role in chemical synthesis by providing a strategic entry point to a range of valuable products with unique properties and functionalities. Its versatility and reactivity make it a valuable building block for the creation of innovative materials and compounds across different industries.