1. Home
  2. Oxacyclotridecan-2-one

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Oxacyclotridecan-2-one

O=C1CCCCCCCCCCCO1 Request for Quotation
Chemical Name: Oxacyclotridecan-2-one
CAS Number: 947-05-7
Product Number: AG003TIH(AGN-PC-0JL9MY)
Synonyms:
MDL No:
Molecular Formula: C12H22O2
Molecular Weight: 198.30188

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Dodecalactone, also known as lauryl lactone, is a versatile compound commonly utilized in chemical synthesis for its unique properties and wide range of applications. This organic compound belongs to the class of lactones, which are cyclic esters formed from hydroxyl and carboxyl groups.In chemical synthesis, dodecalactone serves as a valuable building block for the production of various organic compounds due to its reactivity and ability to participate in diverse chemical reactions. Its 12-membered carbon ring structure imparts stability and structural rigidity, making it a favorable choice for constructing complex molecules in the pharmaceutical, fragrance, and polymer industries.One notable application of dodecalactone is its use as a precursor for the synthesis of artificial flavors and fragrances. This compound contributes pleasant, creamy, and coconut-like aroma notes, making it a popular choice in the formulation of perfumes, cosmetics, and food products. By incorporating dodecalactone into fragrance compositions, chemists can create desirable scents that mimic natural aromas or develop entirely new olfactory experiences.Furthermore, dodecalactone plays a crucial role in polymer chemistry, where it can act as a chain transfer agent or monomer in the production of biodegradable polymers or copolymers. Its unique structure and functional groups provide opportunities for tuning the physical and chemical properties of polymers, enhancing their performance in various applications such as packaging materials, coatings, and biomedical devices.Overall, dodecalactone's versatility and reactivity make it a key ingredient in the toolkit of synthetic chemists seeking to create novel compounds with tailored properties for a wide range of industrial applications.