1. Home
  2. Stannane, trimethylphenyl-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Stannane, trimethylphenyl-

C[Sn](c1ccccc1)(C)C Request for Quotation
Chemical Name: Stannane, trimethylphenyl-
CAS Number: 934-56-5
Product Number: AG003V3L(AGN-PC-0JLO8V)
Synonyms:
MDL No:
Molecular Formula: C9H14Sn
Molecular Weight: 240.90846

Identification/Properties

Properties
Storage:
2-8℃;Inert atmosphere;

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Trimethyl(phenyl)tin, also known as phenyltrimethyltin, is a versatile organotin compound widely used in chemical synthesis for various applications. In organic chemistry, it serves as a valuable reagent for the introduction of phenyl groups into different organic molecules. This can be particularly useful in the synthesis of complex pharmaceuticals, agrochemicals, and other specialty chemicals where the presence of phenyl moiety is essential for the desired biological or physicochemical properties.One of the key applications of trimethyl(phenyl)tin is its role as a coupling partner in metal-catalyzed cross-coupling reactions. By undergoing reactions with various electrophiles, such as aryl halides or pseudohalides, it can facilitate the construction of carbon-carbon and carbon-heteroatom bonds in a controlled and efficient manner. This ability makes it a valuable tool in modern organic synthesis for the preparation of diverse molecular architectures with high selectivity and yield.Furthermore, trimethyl(phenyl)tin can also participate in radical reactions, such as radical addition or substitution processes, offering unique reactivity profiles that enable the formation of structurally complex organic compounds. Its compatibility with a wide range of reaction conditions and functional groups further enhances its utility in the synthesis of novel molecules with tailored properties.Overall, the application of trimethyl(phenyl)tin in chemical synthesis highlights its importance as a versatile reagent for the construction of functionalized organic molecules and the development of innovative synthetic methodologies in modern organic chemistry.