1. Home
  2. Acetamide, N-1,3-benzodioxol-5-yl-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Acetamide, N-1,3-benzodioxol-5-yl-

CC(=O)Nc1ccc2c(c1)OCO2 Request for Quotation
Chemical Name: Acetamide, N-1,3-benzodioxol-5-yl-
CAS Number: 13067-19-1
Product Number: AG009DCB(AGN-PC-0JM35S)
Synonyms:
MDL No:
Molecular Formula: C9H9NO3
Molecular Weight: 179.1727

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


N-1,3-Benzodioxol-5-ylacetamide serves as a versatile building block in organic synthesis due to its unique structural features and reactivity. It is commonly utilized as a key intermediate in the synthesis of pharmaceutical compounds and agrochemicals.One prominent application of N-1,3-Benzodioxol-5-ylacetamide is in the development of novel drug molecules. By strategically modifying its chemical structure, chemists can introduce specific functional groups or stereochemical features that are essential for enhancing the biological activity or optimizing the pharmacokinetic properties of the final drug product. This compound's flexibility in structural modifications makes it a valuable tool in medicinal chemistry research.Additionally, N-1,3-Benzodioxol-5-ylacetamide plays a crucial role in the synthesis of biologically active natural products and fine chemicals. Its ability to undergo various chemical transformations, such as nucleophilic substitutions, oxidative reactions, and cyclization processes, enables the efficient construction of complex molecular scaffolds found in natural products. This compound's synthetic versatility makes it a valuable component in the development of new bioactive compounds with potential therapeutic or industrial applications.