1. Home
  2. ethyl 5-nitro-1H-indole-3-carboxylate

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

ethyl 5-nitro-1H-indole-3-carboxylate

CCOC(=O)c1c[nH]c2c1cc(cc2)[N+](=O)[O-] Request for Quotation
Chemical Name: ethyl 5-nitro-1H-indole-3-carboxylate
CAS Number: 91090-94-7
Product Number: AG006R1P(AGN-PC-0JNVBX)
Synonyms:
MDL No:
Molecular Formula: C11H10N2O4
Molecular Weight: 234.2081

Identification/Properties

Safety Information

GHS Pictogram:
N/A
Signal Word:
UN#:
-
Hazard Statements:
-
Precautionary Statements:
Class:
-
Packing Group:
-

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Ethyl 5-nitro-1H-indole-3-carboxylate is a versatile compound commonly used in chemical synthesis. This compound plays a crucial role in organic chemistry as a key building block for various pharmaceuticals, agrochemicals, and materials. Its unique structure and reactivity make it a valuable intermediate in the synthesis of complex molecules.In chemical synthesis, Ethyl 5-nitro-1H-indole-3-carboxylate can be utilized in the preparation of heterocyclic compounds and drug candidates. By undergoing a series of reactions, this compound can be transformed into structurally diverse derivatives with different functional groups, allowing for the modification of physicochemical properties and biological activities. Additionally, its nitro group provides a versatile handle for further transformations, enabling the introduction of various substituents to fine-tune the properties of the final product.Furthermore, Ethyl 5-nitro-1H-indole-3-carboxylate can serve as a precursor for the synthesis of indole-based dyes, fluorescent probes, and natural products. Its presence in the molecular structure imparts unique properties that are essential for the desired applications. By incorporating this compound into the synthetic route, chemists can access a wide range of compounds with diverse functions and applications in materials science, medicinal chemistry, and other fields of research.