| Chemical Name: | Acetamide, N-(4-bromo-3-chlorophenyl)- | 
| CAS Number: | 22459-81-0 | 
| Product Number: | AG00BCL6(AGN-PC-0KKEX8) | 
| Synonyms: | |
| MDL No: | |
| Molecular Formula: | C8H7BrClNO | 
| Molecular Weight: | 248.5043 | 
 
                                                                                 N-(4-Bromo-3-chlorophenyl)acetamide, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials due to its unique chemical properties. Its functional groups enable it to participate in a wide range of reactions, making it a valuable tool for organic chemists. When incorporated into synthesis pathways, $name$ facilitates the formation of complex molecular structures with high efficiency and precision, making it an essential component in the production of valuable compounds in the field of organic chemistry.