1. Home
  2. 1(3H)-Isobenzofuranone, 6-chloro-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

1(3H)-Isobenzofuranone, 6-chloro-

Clc1ccc2c(c1)C(=O)OC2 Request for Quotation
Chemical Name: 1(3H)-Isobenzofuranone, 6-chloro-
CAS Number: 19641-29-3
Product Number: AG00AD0V(AGN-PC-0LX9EA)
Synonyms:
MDL No:
Molecular Formula: C8H5ClO2
Molecular Weight: 168.5771

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


6-Chloroisobenzofuran-1(3H)-one, also known as $name$, is a versatile compound commonly utilized in chemical synthesis. This compound plays a crucial role as a building block in the synthesis of various organic compounds. It can serve as a key intermediate in the production of pharmaceuticals, agrochemicals, and functional materials.In chemical synthesis, $name$ is often employed as a starting material for the construction of biologically active molecules and advanced materials. Its unique structure and reactivity make it a valuable component in the creation of complex organic compounds with specific functionalities. By incorporating $name$ into synthetic pathways, chemists can access a wide range of diverse molecules with tailored properties.Additionally, 6-Chloroisobenzofuran-1(3H)-one's ability to undergo various chemical transformations, such as substitution reactions and functional group interconversions, makes it a versatile tool for designing and synthesizing new compounds. Its versatility and utility in organic synthesis highlight its importance in the field of chemistry and its significant role in the development of innovative materials and pharmaceuticals.