1. Home
  2. Octanoic acid, 7-methyl-, (4-hydroxy-3-methoxyphenyl)methyl ester

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Octanoic acid, 7-methyl-, (4-hydroxy-3-methoxyphenyl)methyl ester

COc1cc(COC(=O)CCCCCC(C)C)ccc1O Request for Quotation
Chemical Name: Octanoic acid, 7-methyl-, (4-hydroxy-3-methoxyphenyl)methyl ester
CAS Number: 220012-53-3
Product Number: AG01E75I(AGN-PC-0MU0EE)
Synonyms:
MDL No:
Molecular Formula: C17H26O4
Molecular Weight: 294.38594

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


As a professional chemist, I can delve into the intricate application of Nordihydrocapsiate (NDHC) in chemical synthesis. NDHC, a compound found in chili peppers, exhibits promising potential in various chemical reactions and synthetic processes. In the realm of chemical synthesis, NDHC can serve as a valuable substrate or catalyst, enabling the formation of novel compounds with unique properties.Due to its structural characteristics, NDHC can participate in oxidative transformations, allowing for the creation of diverse chemical entities. Additionally, the presence of specific functional groups in NDHC renders it suitable for use in coupling reactions, leading to the synthesis of complex molecules with enhanced functionalities. The reactivity of NDHC towards certain reagents also opens up avenues for the development of efficient synthetic routes for target compounds.Furthermore, the bioavailability and physiological effects of NDHC can be harnessed in the design of bioactive molecules through strategic modifications. By incorporating NDHC-derived motifs into drug molecules or organic frameworks, chemists can explore new avenues in drug discovery and material science.Overall, the versatility of Nordihydrocapsiate in chemical synthesis offers a fertile ground for innovation and exploration in the field of organic chemistry. Its potential applications extend beyond traditional boundaries, paving the way for the development of advanced materials and pharmaceuticals with tailored properties and enhanced performance characteristics.