1. Home
  2. Ethanone, 1-[4-[[4-(dioctylamino)phenyl]azo]phenyl]-2,2,2-trifluoro-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Ethanone, 1-[4-[[4-(dioctylamino)phenyl]azo]phenyl]-2,2,2-trifluoro-

CCCCCCCCN(c1ccc(cc1)N=Nc1ccc(cc1)C(=O)C(F)(F)F)CCCCCCCC Request for Quotation
Chemical Name: Ethanone, 1-[4-[[4-(dioctylamino)phenyl]azo]phenyl]-2,2,2-trifluoro-
CAS Number: 193154-07-3
Product Number: AG00B09Y(AGN-PC-0MU6L1)
Synonyms:
MDL No:
Molecular Formula: C30H42F3N3O
Molecular Weight: 517.6691896

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The compound 1-[4-[2-[4-(Dioctylamino)phenyl]diazenyl]phenyl]-2,2,2-trifluoroethanone, known for its strong chemical reactivity and unique molecular structure, plays a crucial role in chemical synthesis processes. With its trifluoroethanone moiety providing an electron-deficient center and the azo group offering a platform for diazo coupling reactions, this compound is widely utilized as a versatile building block in organic chemistry. In chemical synthesis, this particular compound serves as a valuable intermediate for the production of various functional materials, dyes, and pharmaceutical compounds. Its ability to undergo diverse reactions, such as nucleophilic addition and substitution reactions, enables the formation of complex molecules with tailored properties. Additionally, the presence of the dioctylamino group enhances solubility and provides a steric effect that influences the compound's behavior in different reaction pathways.Overall, the compound's strategic positioning of functional groups and its reactivity make it a valuable tool in designing and synthesizing novel compounds with tailored chemical and physical properties.