1. Home
  2. Benzaldehyde, 2-hydroxy-4-(1-methylethyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzaldehyde, 2-hydroxy-4-(1-methylethyl)-

O=Cc1ccc(cc1O)C(C)C Request for Quotation
Chemical Name: Benzaldehyde, 2-hydroxy-4-(1-methylethyl)-
CAS Number: 536-32-3
Product Number: AG00DLOF(AGN-PC-0MZLP5)
Synonyms:
MDL No:
Molecular Formula: C10H12O2
Molecular Weight: 164.2011

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


The chemical compound 4-Isopropylsalicylaldehyde is a versatile and valuable building block in chemical synthesis. Its unique molecular structure allows it to be used in various reactions for the creation of complex organic compounds. This compound is commonly utilized as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and fragrances.In chemical synthesis, 4-Isopropylsalicylaldehyde serves as a precursor for the preparation of different derivatives through various modification reactions. Its aldehyde functional group can participate in important transformations such as oxidation, reduction, and condensation reactions. These reactions allow chemists to introduce different functional groups or structural moieties, thereby enabling the modification and enhancement of the compound's properties.Moreover, 4-Isopropylsalicylaldehyde can act as a ligand in coordination chemistry, forming complexes with transition metals. These metal complexes exhibit unique reactivity and catalytic properties, making them useful in the development of novel synthetic methodologies. Additionally, the compound's aromatic ring structure can undergo aromatic substitution reactions, expanding the scope of its synthetic applications.Overall, 4-Isopropylsalicylaldehyde plays a crucial role in chemical synthesis by providing a platform for the construction of diverse organic molecules with tailored properties and functionalities. Its versatility and reactivity make it a valuable tool for chemists working in various fields of research and development.