1. Home
  2. 4-(6,7-dimethoxyquinazolin-4-yl)-N-(4-phenoxyphenyl)piperazine-1-carboxamide

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

4-(6,7-dimethoxyquinazolin-4-yl)-N-(4-phenoxyphenyl)piperazine-1-carboxamide

COc1cc2c(cc1OC)ncnc2N1CCN(CC1)C(=O)Nc1ccc(cc1)Oc1ccccc1 Request for Quotation
Chemical Name: 4-(6,7-dimethoxyquinazolin-4-yl)-N-(4-phenoxyphenyl)piperazine-1-carboxamide
CAS Number: 205254-94-0
Product Number: AG0029YW(AGN-PC-0NCM3B)
Synonyms:
MDL No:
Molecular Formula: C27H27N5O4
Molecular Weight: 485.5344

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


PDGFR Tyrosine Kinase Inhibitor III is a valuable compound used in chemical synthesis for its ability to selectively target and inhibit the activity of the platelet-derived growth factor receptor (PDGFR) tyrosine kinase enzyme. This inhibitor plays a crucial role in blocking the phosphorylation process of target proteins, which is essential in regulating various cellular processes.In chemical synthesis, PDGFR Tyrosine Kinase Inhibitor III is utilized as a key reagent in the development of novel pharmaceuticals and bioactive molecules. By specifically inhibiting PDGFR, it helps researchers in studying the intricate signaling pathways associated with cell growth, proliferation, and differentiation. This compound serves as a powerful tool for investigating the mechanisms underlying various diseases, such as cancer, where aberrant PDGFR signaling is implicated.Furthermore, PDGFR Tyrosine Kinase Inhibitor III can be employed in the synthesis of targeted drug delivery systems and in the design of new therapeutic agents aimed at modulating specific cellular pathways. Its precise targeting capability makes it an indispensable component in medicinal chemistry research and drug discovery efforts, paving the way for the development of innovative treatments with enhanced efficacy and reduced side effects.