1. Home
  2. Benzaldehyde, 3-methoxy-2-(2-propenyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzaldehyde, 3-methoxy-2-(2-propenyl)-

C=CCc1c(OC)cccc1C=O Request for Quotation
Chemical Name: Benzaldehyde, 3-methoxy-2-(2-propenyl)-
CAS Number: 94956-98-6
Product Number: AG006QRZ(AGN-PC-0NGVBK)
Synonyms:
MDL No:
Molecular Formula: C11H12O2
Molecular Weight: 176.2118

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Benzaldehyde, 3-methoxy-2-(2-propenyl)- is a versatile compound that finds application in various chemical synthesis processes. Its aldehyde functional group allows for it to participate in numerous reactions and transformations, making it a valuable building block in organic chemistry.One common use of Benzaldehyde, 3-methoxy-2-(2-propenyl)- is in the synthesis of heterocyclic compounds, particularly in the formation of cyclic ethers and esters. Its ability to undergo aldol condensation reactions enables the production of complex molecules with multiple functional groups.Furthermore, Benzaldehyde, 3-methoxy-2-(2-propenyl)- can be utilized in the preparation of pharmaceutical intermediates and natural product synthesis. Its presence in the molecular structure of certain compounds imparts specific characteristics and biological activities, making it essential in drug discovery and development.Overall, Benzaldehyde, 3-methoxy-2-(2-propenyl)- is a key component in the toolkit of synthetic chemists, enabling the construction of diverse chemical entities with wide-ranging applications. Its reactivity and functional group compatibility make it a valuable asset in the realm of chemical synthesis.