1. Home
  2. 7-Dodecen-1-ol, (7Z)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

7-Dodecen-1-ol, (7Z)-

CCCC/C=CCCCCCCO Request for Quotation
Chemical Name: 7-Dodecen-1-ol, (7Z)-
CAS Number: 20056-92-2
Product Number: AG00BG7X(AGN-PC-0O7137)
Synonyms:
MDL No:
Molecular Formula: C12H24O
Molecular Weight: 184.31836

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Cis-7-dodecen-1-ol, also known as 7-dodecen-1-ol, plays a crucial role in chemical synthesis as a versatile building block in the production of various compounds and materials. With its unique structure and properties, this compound is widely used in organic chemistry for the synthesis of a wide range of products.One key application of cis-7-dodecen-1-ol is as a precursor in the preparation of fragrances and flavors. Its long carbon chain and alcohol functional group make it valuable in the creation of complex aroma compounds, adding pleasant scents to perfumes, cosmetics, and food products. The compound's ability to undergo various chemical reactions allows for the tailored synthesis of specific fragrance components, enhancing the overall olfactory experience.In addition to its use in fragrance synthesis, cis-7-dodecen-1-ol serves as a building block in the production of surfactants and emulsifiers. Its amphiphilic nature, stemming from the combination of a hydrophobic tail and a hydrophilic alcohol group, makes it ideal for formulating products that require surface activity and emulsifying properties. By incorporating this compound into formulations, chemists can create stable emulsions, improve dispersibility, and enhance the efficacy of cleaning agents and personal care products.Furthermore, cis-7-dodecen-1-ol can be employed in the synthesis of biologically active compounds and pharmaceutical intermediates. Its chemical reactivity and potential for structural modification enable the creation of diverse molecules with specific biological functions. By utilizing this compound as a starting material, researchers can develop new drugs, agrochemicals, and biochemical probes, contributing to advancements in the field of medicinal chemistry and biotechnology.