1. Home
  2. 2-Propenoyl chloride, 3-(2-furanyl)-, (E)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2-Propenoyl chloride, 3-(2-furanyl)-, (E)-

ClC(=O)/C=C/c1ccco1 Request for Quotation
Chemical Name: 2-Propenoyl chloride, 3-(2-furanyl)-, (E)-
CAS Number: 63485-67-6
Product Number: AG00ELF0(AGN-PC-0OE7YS)
Synonyms:
MDL No:
Molecular Formula: C7H5ClO2
Molecular Weight: 156.5664

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


(2E)-3-(Furan-2-yl)prop-2-enoyl chloride is a versatile compound widely used in chemical synthesis. This compound serves as a key intermediate in the production of various organic compounds due to its unique reactivity and functional group compatibility.In organic synthesis, (2E)-3-(Furan-2-yl)prop-2-enoyl chloride is commonly employed as a reagent for the acylation of nucleophiles such as amines and alcohols. The acylation reaction involves the transfer of the acyl group from the (2E)-3-(Furan-2-yl)prop-2-enoyl chloride molecule to the nucleophile, leading to the formation of new carbon-carbon and carbon-nitrogen bonds.Furthermore, this compound can undergo various chemical transformations such as nucleophilic addition, substitution, and elimination reactions, making it a valuable building block in the synthesis of complex organic molecules. Its functional group, the enoyl chloride moiety, provides opportunities for further derivatization and modification, allowing chemists to tailor the structure of the final product according to specific requirements.Overall, (2E)-3-(Furan-2-yl)prop-2-enoyl chloride plays a crucial role in facilitating the efficient and selective formation of a wide range of organic compounds in chemical synthesis.