1. Home
  2. 2H-1,2,4-Oxadiazine,5,6-dihydro-5-(1-piperidinylmethyl)-3-(3-pyridinyl)-

Contact Angene

Tel: +852 8191 6999

Email: [email protected]

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

2H-1,2,4-Oxadiazine,5,6-dihydro-5-(1-piperidinylmethyl)-3-(3-pyridinyl)-

C1CCN(CC1)CC1CONC(=N1)c1cccnc1 Request for Quotation
Chemical Name: 2H-1,2,4-Oxadiazine,5,6-dihydro-5-(1-piperidinylmethyl)-3-(3-pyridinyl)-
CAS Number: 203805-20-3
Product Number: AG002954(AGN-PC-0QU0XW)
Synonyms:
MDL No:
Molecular Formula: C14H20N4O
Molecular Weight: 260.3348

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


IROXANADINE is a powerful and versatile compound that plays a key role in chemical synthesis. With its unique structure and reactivity, IROXANADINE serves as a valuable building block for the creation of complex organic molecules. In particular, IROXANADINE is commonly employed in the creation of pharmaceuticals, agrochemicals, and advanced materials.Due to its ability to participate in a wide range of chemical reactions, IROXANADINE enables chemists to access diverse molecular scaffolds and functional groups. This versatility makes IROXANADINE an essential component in the synthesis of various biologically active compounds, allowing for the development of new drugs and therapeutic agents. Additionally, IROXANADINE can be utilized in the creation of specialty chemicals and innovative materials with tailored properties.Furthermore, the unique structural features of IROXANADINE make it a valuable tool for the construction of complex molecular architectures with high efficiency and precision. Its robust chemical reactivity allows for the selective modification of specific sites within a molecule, enabling the synthesis of intricate molecular structures that would be challenging to access using conventional methods.Overall, IROXANADINE's versatility and reactivity make it an indispensable resource in the realm of chemical synthesis, offering endless possibilities for the creation of novel compounds with diverse applications.