1. Home
  2. Benzoic acid,3-amino methyl-5-bromo methyl ester

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Benzoic acid,3-amino methyl-5-bromo methyl ester

Request for Quotation
Chemical Name: Benzoic acid,3-amino methyl-5-bromo methyl ester
CAS Number: 1393540-29-8
Product Number: AG01JMON(AGN-PC-0WAL3J)
Synonyms:
MDL No:
Molecular Formula:
Molecular Weight:

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Methyl 3-(aminomethyl)-5-bromobenzoate is a versatile compound widely utilized in chemical synthesis for its unique properties and reactivity. This molecule serves as a key building block in the creation of various important organic compounds, particularly in the pharmaceutical and agrochemical industries. One of the primary applications of Methyl 3-(aminomethyl)-5-bromobenzoate lies in its role as a precursor in the synthesis of novel pharmaceutical agents. Its structural features make it a valuable starting material for the modification and development of potential drug candidates. By incorporating this compound into different chemical reactions, chemists can access a diverse array of derivatives with enhanced biological activities and pharmacological profiles.Furthermore, the presence of functional groups such as the amino and bromo moieties in Methyl 3-(aminomethyl)-5-bromobenzoate enables selective transformations through various synthetic methodologies. This allows for the strategic modification of the compound to introduce specific functionalities or molecular scaffolds essential for target-oriented synthesis. Its versatility and compatibility with a wide range of chemical reactions make it a valuable asset in the design and production of structurally complex molecules.Overall, Methyl 3-(aminomethyl)-5-bromobenzoate plays a crucial role in the advancement of chemical synthesis, particularly in the creation of bioactive compounds with potential therapeutic applications. Its utility as a key intermediate underscores its importance in the synthesis of diverse chemical entities, showcasing its significance in modern organic chemistry practices.