Chemical Name: | Fmoc-Aph(Hor)-Aph(Hor)-OH |
CAS Number: | |
Product Number: | AGN-PC-0WALR6 |
Synonyms: | |
MDL No: | |
Molecular Formula: | |
Molecular Weight: |
The chemical structure of [(3S)-3-[(5R,6S)-2-carboxy-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]pyrrolidin-1-yl]methylidene-dimethylazanium (C16H24N3O4+) is quite complex and involves several stereocenters. Unfortunately, the structure is too complex to be accurately represented here in text form. However, it describes a molecule with a pyrrolidinyl group and a quaternary ammonium cation, along with a bicyclic heptene lactam moiety.