1. Home
  2. Tert-Butyl 1-Oxo-2,11-Diazaspiro[6.7]Tetradecane-11-Carboxylate

Contact Angene

Tel: +852 8191 6999

Email: sales@angenechemical.com

Brc1cnc(nc1)C
Pyrimidine, 5-bromo-2-methyl-
CCCP1(=O)OP(=O)(CCC)OP(=O)(O1)CCC
1,3,5,2,4,6-Trioxatriphosphorinane, 2,4,6-tripropyl-, 2,4,6-trioxide
CC1(C)OB(OC1(C)C)B1OC(C(O1)(C)C)(C)C
2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl-
O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Pd].[Pd]
Tris(dibenzylideneacetone)dipalladium
C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.Cc1cc(C)c(c(c1)C)N1CCN(C1=[Ru](=Cc1ccccc1)(Cl)Cl)c1c(C)cc(cc1C)C
Ruthenium,[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene]dichloro(phenylmethylene)(tricyclohexylphosphine)-, (SP-5-41)-

Tert-Butyl 1-Oxo-2,11-Diazaspiro[6.7]Tetradecane-11-Carboxylate

O=C(N1CCCC2(CCC1)CCCCNC2=O)OC(C)(C)C Request for Quotation
Chemical Name: Tert-Butyl 1-Oxo-2,11-Diazaspiro[6.7]Tetradecane-11-Carboxylate
CAS Number: 1250999-07-5
Product Number: AG00HHY9(AGN-PC-0WG4EJ)
Synonyms:
MDL No:
Molecular Formula: C17H30N2O3
Molecular Weight: 310.4317

Identification/Properties

Safety Information

NMR Spectrum

Other Analytical Data

Request for Quotation

Customer Feedback

Chemical Structure


Tert-Butyl 1-oxo-2,11-diazaspiro[6.7]tetradecane-11-carboxylate is a versatile compound commonly used in chemical synthesis due to its unique chemical structure and reactivity. This compound serves as a valuable building block in the creation of complex organic molecules, particularly in the field of medicinal chemistry and drug development.Its spirocyclic structure imparts steric hindrance and rigidity, making it a useful scaffold for constructing biologically active compounds. The t-butyl and oxo groups can be selectively modified to introduce various functional groups, allowing for tailored modifications to the molecule's properties. Additionally, the presence of the diaza moiety offers opportunities for coordination chemistry and potential interactions with metal ions.In chemical synthesis, tert-Butyl 1-oxo-2,11-diazaspiro[6.7]tetradecane-11-carboxylate can be employed as a key intermediate in the production of pharmacologically relevant compounds, natural product derivatives, and complex heterocyclic structures. Its incorporation into synthetic pathways can enable the efficient construction of diverse molecular architectures with specific biological activities or physical properties.